C22H26N4OS2 — CID 137411863
N-[3-(tert-butylamino)sulfanyl-4-[2-[4-(methylamino)phenyl]-1,3-thiazol-5-yl]phenyl]acetamide (PubChem CID 137411863) has the molecular formula C22H26N4OS2 and a molecular weight of 426.61 g/mol. Its IUPAC name is N-[3-(tert-butylamino)sulfanyl-4-[2-[4-(methylamino)phenyl]-1,3-thiazol-5-yl]phenyl]acetamide.
| Compound Name | N-[3-(tert-butylamino)sulfanyl-4-[2-[4-(methylamino)phenyl]-1,3-thiazol-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 137411863 |
| Molecular Formula | C22H26N4OS2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N-[3-(tert-butylamino)sulfanyl-4-[2-[4-(methylamino)phenyl]-1,3-thiazol-5-yl]phenyl]acetamide |
| SMILES | CNc1ccc(-c2ncc(-c3ccc(NC(C)=O)cc3SNC(C)(C)C)s2)cc1 |
| InChI | InChI=1S/C22H26N4OS2/c1-14(27)25-17-10-11-18(19(12-17)29-26-22(2,3)4)20-13-24-21(28-20)15-6-8-16(23-5)9-7-15/h6-13,23,26H,1-5H3,(H,25,27) |
| InChIKey | SRVONXHMJHXCCM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|