C28H31N5OS2 — CID 137411961
1-[4-[2-(4-aminophenyl)-1,3-thiazol-5-yl]-3-(tert-butylamino)sulfanylphenyl]-3-benzyl-1-methylurea (PubChem CID 137411961) has the molecular formula C28H31N5OS2 and a molecular weight of 517.72 g/mol. Its IUPAC name is 1-[4-[2-(4-aminophenyl)-1,3-thiazol-5-yl]-3-(tert-butylamino)sulfanylphenyl]-3-benzyl-1-methylurea.
| Compound Name | 1-[4-[2-(4-aminophenyl)-1,3-thiazol-5-yl]-3-(tert-butylamino)sulfanylphenyl]-3-benzyl-1-methylurea |
|---|---|
| PubChem CID | 137411961 |
| Molecular Formula | C28H31N5OS2 |
| Molecular Weight | 517.72 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 1-[4-[2-(4-aminophenyl)-1,3-thiazol-5-yl]-3-(tert-butylamino)sulfanylphenyl]-3-benzyl-1-methylurea |
| SMILES | CN(C(=O)NCc1ccccc1)c1ccc(-c2cnc(-c3ccc(N)cc3)s2)c(SNC(C)(C)C)c1 |
| InChI | InChI=1S/C28H31N5OS2/c1-28(2,3)32-36-24-16-22(33(4)27(34)31-17-19-8-6-5-7-9-19)14-15-23(24)25-18-30-26(35-25)20-10-12-21(29)13-11-20/h5-16,18,32H,17,29H2,1-4H3,(H,31,34) |
| InChIKey | YOWKNVNGLMOEES-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.72 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|