C27H34N4OS2 — CID 155429003
1-benzyl-3-[3-(tert-butylamino)sulfanyl-4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]urea (PubChem CID 155429003) has the molecular formula C27H34N4OS2 and a molecular weight of 494.73 g/mol. Its IUPAC name is 1-benzyl-3-[3-(tert-butylamino)sulfanyl-4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]urea.
| Compound Name | 1-benzyl-3-[3-(tert-butylamino)sulfanyl-4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 155429003 |
| Molecular Formula | C27H34N4OS2 |
| Molecular Weight | 494.73 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 1-benzyl-3-[3-(tert-butylamino)sulfanyl-4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]urea |
| SMILES | CC(C)(C)NSc1cc(NC(=O)NCc2ccccc2)ccc1-c1cnc(C2CCCCC2)s1 |
| InChI | InChI=1S/C27H34N4OS2/c1-27(2,3)31-34-23-16-21(30-26(32)29-17-19-10-6-4-7-11-19)14-15-22(23)24-18-28-25(33-24)20-12-8-5-9-13-20/h4,6-7,10-11,14-16,18,20,31H,5,8-9,12-13,17H2,1-3H3,(H2,29,30,32) |
| InChIKey | ZOLFVWMYMBBZNM-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.73 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|