C28H35N5OS2 — CID 167262760
N-[3-(tert-butylamino)sulfanyl-4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-3,4-dihydro-1H-2,6-naphthyridine-2-carboxamide (PubChem CID 167262760) has the molecular formula C28H35N5OS2 and a molecular weight of 521.76 g/mol. Its IUPAC name is N-[3-(tert-butylamino)sulfanyl-4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-3,4-dihydro-1H-2,6-naphthyridine-2-carboxamide.
| Compound Name | N-[3-(tert-butylamino)sulfanyl-4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-3,4-dihydro-1H-2,6-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 167262760 |
| Molecular Formula | C28H35N5OS2 |
| Molecular Weight | 521.76 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | N-[3-(tert-butylamino)sulfanyl-4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-3,4-dihydro-1H-2,6-naphthyridine-2-carboxamide |
| SMILES | CC(C)(C)NSc1cc(NC(=O)N2CCc3cnccc3C2)ccc1-c1cnc(C2CCCCC2)s1 |
| InChI | InChI=1S/C28H35N5OS2/c1-28(2,3)32-36-24-15-22(31-27(34)33-14-12-20-16-29-13-11-21(20)18-33)9-10-23(24)25-17-30-26(35-25)19-7-5-4-6-8-19/h9-11,13,15-17,19,32H,4-8,12,14,18H2,1-3H3,(H,31,34) |
| InChIKey | FMQJUNIAMWBOEO-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.76 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|