C28H36N4O2S2 — CID 167083645
1-[3-(tert-butylamino)oxysulfanyl-4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-3-(1-phenylethyl)urea (PubChem CID 167083645) has the molecular formula C28H36N4O2S2 and a molecular weight of 524.76 g/mol. Its IUPAC name is 1-[3-(tert-butylamino)oxysulfanyl-4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-3-(1-phenylethyl)urea.
| Compound Name | 1-[3-(tert-butylamino)oxysulfanyl-4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-3-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 167083645 |
| Molecular Formula | C28H36N4O2S2 |
| Molecular Weight | 524.76 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 1-[3-(tert-butylamino)oxysulfanyl-4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-3-(1-phenylethyl)urea |
| SMILES | CC(NC(=O)Nc1ccc(-c2cnc(C3CCCCC3)s2)c(SONC(C)(C)C)c1)c1ccccc1 |
| InChI | InChI=1S/C28H36N4O2S2/c1-19(20-11-7-5-8-12-20)30-27(33)31-22-15-16-23(24(17-22)36-34-32-28(2,3)4)25-18-29-26(35-25)21-13-9-6-10-14-21/h5,7-8,11-12,15-19,21,32H,6,9-10,13-14H2,1-4H3,(H2,30,31,33) |
| InChIKey | URBZSSSFXATFET-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.76 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|