C22H29N5S2 — CID 167262318
N-[3-(tert-butylamino)sulfanyl-4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-1H-pyrazol-5-amine (PubChem CID 167262318) has the molecular formula C22H29N5S2 and a molecular weight of 427.64 g/mol. Its IUPAC name is N-[3-(tert-butylamino)sulfanyl-4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-1H-pyrazol-5-amine.
| Compound Name | N-[3-(tert-butylamino)sulfanyl-4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 167262318 |
| Molecular Formula | C22H29N5S2 |
| Molecular Weight | 427.64 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | N-[3-(tert-butylamino)sulfanyl-4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-1H-pyrazol-5-amine |
| SMILES | CC(C)(C)NSc1cc(Nc2ccn[nH]2)ccc1-c1cnc(C2CCCCC2)s1 |
| InChI | InChI=1S/C22H29N5S2/c1-22(2,3)27-29-18-13-16(25-20-11-12-24-26-20)9-10-17(18)19-14-23-21(28-19)15-7-5-4-6-8-15/h9-15,27H,4-8H2,1-3H3,(H2,24,25,26) |
| InChIKey | PSEMFXDGWXQGBH-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.64 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|