C24H34BrN3O2S2 — CID 167262603
butan-2-yl N-[4-[5-[4-bromo-2-(tert-butylamino)sulfanylphenyl]-1,3-thiazol-2-yl]cyclohexyl]carbamate (PubChem CID 167262603) has the molecular formula C24H34BrN3O2S2 and a molecular weight of 540.59 g/mol. Its IUPAC name is butan-2-yl N-[4-[5-[4-bromo-2-(tert-butylamino)sulfanylphenyl]-1,3-thiazol-2-yl]cyclohexyl]carbamate.
| Compound Name | butan-2-yl N-[4-[5-[4-bromo-2-(tert-butylamino)sulfanylphenyl]-1,3-thiazol-2-yl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 167262603 |
| Molecular Formula | C24H34BrN3O2S2 |
| Molecular Weight | 540.59 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | butan-2-yl N-[4-[5-[4-bromo-2-(tert-butylamino)sulfanylphenyl]-1,3-thiazol-2-yl]cyclohexyl]carbamate |
| SMILES | CCC(C)OC(=O)NC1CCC(c2ncc(-c3ccc(Br)cc3SNC(C)(C)C)s2)CC1 |
| InChI | InChI=1S/C24H34BrN3O2S2/c1-6-15(2)30-23(29)27-18-10-7-16(8-11-18)22-26-14-21(31-22)19-12-9-17(25)13-20(19)32-28-24(3,4)5/h9,12-16,18,28H,6-8,10-11H2,1-5H3,(H,27,29) |
| InChIKey | HFMZBXCZHHNJSW-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.59 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|