C19H24FN3O2S — CID 169263311
propan-2-yl N-[4-[5-(4-amino-2-fluorophenyl)-1,3-thiazol-2-yl]cyclohexyl]carbamate (PubChem CID 169263311) has the molecular formula C19H24FN3O2S and a molecular weight of 377.49 g/mol. Its IUPAC name is propan-2-yl N-[4-[5-(4-amino-2-fluorophenyl)-1,3-thiazol-2-yl]cyclohexyl]carbamate.
| Compound Name | propan-2-yl N-[4-[5-(4-amino-2-fluorophenyl)-1,3-thiazol-2-yl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 169263311 |
| Molecular Formula | C19H24FN3O2S |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | propan-2-yl N-[4-[5-(4-amino-2-fluorophenyl)-1,3-thiazol-2-yl]cyclohexyl]carbamate |
| SMILES | CC(C)OC(=O)NC1CCC(c2ncc(-c3ccc(N)cc3F)s2)CC1 |
| InChI | InChI=1S/C19H24FN3O2S/c1-11(2)25-19(24)23-14-6-3-12(4-7-14)18-22-10-17(26-18)15-8-5-13(21)9-16(15)20/h5,8-12,14H,3-4,6-7,21H2,1-2H3,(H,23,24) |
| InChIKey | CZUKLXXAXVHMEK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|