C23H32FN5O2S — CID 169263435
propan-2-yl N-[4-[5-[2-fluoro-4-[(N'-propan-2-ylcarbamimidoyl)amino]phenyl]-1,3-thiazol-2-yl]cyclohexyl]carbamate (PubChem CID 169263435) has the molecular formula C23H32FN5O2S and a molecular weight of 461.61 g/mol. Its IUPAC name is propan-2-yl N-[4-[5-[2-fluoro-4-[(N'-propan-2-ylcarbamimidoyl)amino]phenyl]-1,3-thiazol-2-yl]cyclohexyl]carbamate.
| Compound Name | propan-2-yl N-[4-[5-[2-fluoro-4-[(N'-propan-2-ylcarbamimidoyl)amino]phenyl]-1,3-thiazol-2-yl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 169263435 |
| Molecular Formula | C23H32FN5O2S |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | propan-2-yl N-[4-[5-[2-fluoro-4-[(N'-propan-2-ylcarbamimidoyl)amino]phenyl]-1,3-thiazol-2-yl]cyclohexyl]carbamate |
| SMILES | CC(C)/N=C(\N)Nc1ccc(-c2cnc(C3CCC(NC(=O)OC(C)C)CC3)s2)c(F)c1 |
| InChI | InChI=1S/C23H32FN5O2S/c1-13(2)27-22(25)28-17-9-10-18(19(24)11-17)20-12-26-21(32-20)15-5-7-16(8-6-15)29-23(30)31-14(3)4/h9-16H,5-8H2,1-4H3,(H,29,30)(H3,25,27,28) |
| InChIKey | CSNVYDSZTHYSEO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|