C22H31N3OS2 — CID 169263598
S-[2-(2-cyclohexyl-1,3-thiazol-5-yl)-5-[[3-(2-methylpropyl)oxetan-3-yl]amino]phenyl]thiohydroxylamine (PubChem CID 169263598) has the molecular formula C22H31N3OS2 and a molecular weight of 417.64 g/mol. Its IUPAC name is S-[2-(2-cyclohexyl-1,3-thiazol-5-yl)-5-[[3-(2-methylpropyl)oxetan-3-yl]amino]phenyl]thiohydroxylamine.
| Compound Name | S-[2-(2-cyclohexyl-1,3-thiazol-5-yl)-5-[[3-(2-methylpropyl)oxetan-3-yl]amino]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 169263598 |
| Molecular Formula | C22H31N3OS2 |
| Molecular Weight | 417.64 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | S-[2-(2-cyclohexyl-1,3-thiazol-5-yl)-5-[[3-(2-methylpropyl)oxetan-3-yl]amino]phenyl]thiohydroxylamine |
| SMILES | CC(C)CC1(Nc2ccc(-c3cnc(C4CCCCC4)s3)c(SN)c2)COC1 |
| InChI | InChI=1S/C22H31N3OS2/c1-15(2)11-22(13-26-14-22)25-17-8-9-18(19(10-17)28-23)20-12-24-21(27-20)16-6-4-3-5-7-16/h8-10,12,15-16,25H,3-7,11,13-14,23H2,1-2H3 |
| InChIKey | HJAUHZJJSFXAFG-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.64 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|