About 2-(2-cyclohexyl-1,3-thiazol-5-yl)-N-methyl-5-(3-methylbutoxy)benzenesulfonamide
2-(2-cyclohexyl-1,3-thiazol-5-yl)-N-methyl-5-(3-methylbutoxy)benzenesulfonamide (PubChem CID 155693695) has the molecular formula C21H30N2O3S2
and a molecular weight of 422.62 g/mol. Its IUPAC name is 2-(2-cyclohexyl-1,3-thiazol-5-yl)-N-methyl-5-(3-methylbutoxy)benzenesulfonamide.
Molecular Properties
| Compound Name | 2-(2-cyclohexyl-1,3-thiazol-5-yl)-N-methyl-5-(3-methylbutoxy)benzenesulfonamide |
| PubChem CID | 155693695 |
| Molecular Formula | C21H30N2O3S2 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 2-(2-cyclohexyl-1,3-thiazol-5-yl)-N-methyl-5-(3-methylbutoxy)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(OCCC(C)C)ccc1-c1cnc(C2CCCCC2)s1 |
| InChI | InChI=1S/C21H30N2O3S2/c1-15(2)11-12-26-17-9-10-18(20(13-17)28(24,25)22-3)19-14-23-21(27-19)16-7-5-4-6-8-16/h9-10,13-16,22H,4-8,11-12H2,1-3H3 |
| InChIKey | JDLASHDCBLHWGG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-cyclohexyl-1,3-thiazol-5-yl)-N-methyl-5-(3-methylbutoxy)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyclohexyl-1,3-thiazol-5-yl)-N-methyl-5-(3-methylbutoxy)benzenesulfonamide?
The IUPAC name of 2-(2-cyclohexyl-1,3-thiazol-5-yl)-N-methyl-5-(3-methylbutoxy)benzenesulfonamide (CID 155693695) is 2-(2-cyclohexyl-1,3-thiazol-5-yl)-N-methyl-5-(3-methylbutoxy)benzenesulfonamide.
What is the SMILES notation for 2-(2-cyclohexyl-1,3-thiazol-5-yl)-N-methyl-5-(3-methylbutoxy)benzenesulfonamide?
The canonical SMILES for 2-(2-cyclohexyl-1,3-thiazol-5-yl)-N-methyl-5-(3-methylbutoxy)benzenesulfonamide is CNS(=O)(=O)c1cc(OCCC(C)C)ccc1-c1cnc(C2CCCCC2)s1.
What is the InChIKey of 2-(2-cyclohexyl-1,3-thiazol-5-yl)-N-methyl-5-(3-methylbutoxy)benzenesulfonamide?
The InChIKey is JDLASHDCBLHWGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N2O3S2/c1-15(2)11-12-26-17-9-10-18(20(13-17)28(24,25)22-3)19-14-23-21(27-19)16-7-5-4-6-8-16/h9-10,13-16,22H,4-8,11-12H2,1-3H3.
What are the key properties of 2-(2-cyclohexyl-1,3-thiazol-5-yl)-N-methyl-5-(3-methylbutoxy)benzenesulfonamide?
2-(2-cyclohexyl-1,3-thiazol-5-yl)-N-methyl-5-(3-methylbutoxy)benzenesulfonamide has a molecular weight of 422.62 g/mol, XLogP of 5.19, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyclohexyl-1,3-thiazol-5-yl)-N-methyl-5-(3-methylbutoxy)benzenesulfonamide is sourced from PubChem (CID 155693695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).