C27H37N5O3S2 — CID 167083671
1-[3-(tert-butylsulfamoyl)-4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-3-[(3Z,5Z)-6-(methylideneamino)hexa-3,5-dienyl]urea (PubChem CID 167083671) has the molecular formula C27H37N5O3S2 and a molecular weight of 543.76 g/mol. Its IUPAC name is 1-[3-(tert-butylsulfamoyl)-4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-3-[(3Z,5Z)-6-(methylideneamino)hexa-3,5-dienyl]urea.
| Compound Name | 1-[3-(tert-butylsulfamoyl)-4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-3-[(3Z,5Z)-6-(methylideneamino)hexa-3,5-dienyl]urea |
|---|---|
| PubChem CID | 167083671 |
| Molecular Formula | C27H37N5O3S2 |
| Molecular Weight | 543.76 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | 1-[3-(tert-butylsulfamoyl)-4-(2-cyclohexyl-1,3-thiazol-5-yl)phenyl]-3-[(3Z,5Z)-6-(methylideneamino)hexa-3,5-dienyl]urea |
| SMILES | C=N/C=C\C=C/CCNC(=O)Nc1ccc(-c2cnc(C3CCCCC3)s2)c(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C27H37N5O3S2/c1-27(2,3)32-37(34,35)24-18-21(31-26(33)29-17-11-6-5-10-16-28-4)14-15-22(24)23-19-30-25(36-23)20-12-8-7-9-13-20/h5-6,10,14-16,18-20,32H,4,7-9,11-13,17H2,1-3H3,(H2,29,31,33)/b6-5-,16-10- |
| InChIKey | AKADMCQUTKOMTM-PEALFLFQSA-N |
| XLogP | 6.22 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.76 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|