C31H43N5O6S2 — CID 155425623
propan-2-yl N-[(3R,6S)-6-[5-[2-(tert-butylsulfamoyl)-4-[[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]carbamoylamino]phenyl]-1,3-thiazol-2-yl]oxan-3-yl]carbamate (PubChem CID 155425623) has the molecular formula C31H43N5O6S2 and a molecular weight of 645.85 g/mol. Its IUPAC name is propan-2-yl N-[(3R,6S)-6-[5-[2-(tert-butylsulfamoyl)-4-[[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]carbamoylamino]phenyl]-1,3-thiazol-2-yl]oxan-3-yl]carbamate.
| Compound Name | propan-2-yl N-[(3R,6S)-6-[5-[2-(tert-butylsulfamoyl)-4-[[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]carbamoylamino]phenyl]-1,3-thiazol-2-yl]oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 155425623 |
| Molecular Formula | C31H43N5O6S2 |
| Molecular Weight | 645.85 g/mol |
| Exact Mass | 645.27 |
| IUPAC Name | propan-2-yl N-[(3R,6S)-6-[5-[2-(tert-butylsulfamoyl)-4-[[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]carbamoylamino]phenyl]-1,3-thiazol-2-yl]oxan-3-yl]carbamate |
| SMILES | C=C/C=C(\C=C/C)CNC(=O)Nc1ccc(-c2cnc([C@@H]3CC[C@@H](NC(=O)OC(C)C)CO3)s2)c(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C31H43N5O6S2/c1-8-10-21(11-9-2)17-33-29(37)34-22-12-14-24(27(16-22)44(39,40)36-31(5,6)7)26-18-32-28(43-26)25-15-13-23(19-41-25)35-30(38)42-20(3)4/h8-12,14,16,18,20,23,25,36H,1,13,15,17,19H2,2-7H3,(H,35,38)(H2,33,34,37)/b11-9-,21-10+/t23-,25+/m1/s1 |
| InChIKey | WZWSMUNSZNPWER-JTFQYRCJSA-N |
| XLogP | 6.05 |
| TPSA | 147.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.85 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|