C30H39N5O6S3 — CID 139296097
propan-2-yl N-[(3R,6S)-6-[5-[4-(benzylcarbamoylamino)-2-(tert-butylsulfamoyl)phenyl]-1,3-thiazol-2-yl]oxan-3-yl]sulfanylcarbamate (PubChem CID 139296097) has the molecular formula C30H39N5O6S3 and a molecular weight of 661.87 g/mol. Its IUPAC name is propan-2-yl N-[(3R,6S)-6-[5-[4-(benzylcarbamoylamino)-2-(tert-butylsulfamoyl)phenyl]-1,3-thiazol-2-yl]oxan-3-yl]sulfanylcarbamate.
| Compound Name | propan-2-yl N-[(3R,6S)-6-[5-[4-(benzylcarbamoylamino)-2-(tert-butylsulfamoyl)phenyl]-1,3-thiazol-2-yl]oxan-3-yl]sulfanylcarbamate |
|---|---|
| PubChem CID | 139296097 |
| Molecular Formula | C30H39N5O6S3 |
| Molecular Weight | 661.87 g/mol |
| Exact Mass | 661.21 |
| IUPAC Name | propan-2-yl N-[(3R,6S)-6-[5-[4-(benzylcarbamoylamino)-2-(tert-butylsulfamoyl)phenyl]-1,3-thiazol-2-yl]oxan-3-yl]sulfanylcarbamate |
| SMILES | CC(C)OC(=O)NS[C@@H]1CC[C@@H](c2ncc(-c3ccc(NC(=O)NCc4ccccc4)cc3S(=O)(=O)NC(C)(C)C)s2)OC1 |
| InChI | InChI=1S/C30H39N5O6S3/c1-19(2)41-29(37)34-43-22-12-14-24(40-18-22)27-31-17-25(42-27)23-13-11-21(15-26(23)44(38,39)35-30(3,4)5)33-28(36)32-16-20-9-7-6-8-10-20/h6-11,13,15,17,19,22,24,35H,12,14,16,18H2,1-5H3,(H,34,37)(H2,32,33,36)/t22-,24+/m1/s1 |
| InChIKey | SHFMTFNCUDYUFQ-VWNXMTODSA-N |
| XLogP | 6.21 |
| TPSA | 147.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.87 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|