C37H50N4O5S2 — CID 167280371
propan-2-yl 5-[4-[5-[4-(benzylcarbamoylamino)-2-(tert-butylsulfamoyl)phenyl]-1,3-thiazol-2-yl]-1-bicyclo[2.2.2]octanyl]pentanoate (PubChem CID 167280371) has the molecular formula C37H50N4O5S2 and a molecular weight of 694.96 g/mol. Its IUPAC name is propan-2-yl 5-[4-[5-[4-(benzylcarbamoylamino)-2-(tert-butylsulfamoyl)phenyl]-1,3-thiazol-2-yl]-1-bicyclo[2.2.2]octanyl]pentanoate.
| Compound Name | propan-2-yl 5-[4-[5-[4-(benzylcarbamoylamino)-2-(tert-butylsulfamoyl)phenyl]-1,3-thiazol-2-yl]-1-bicyclo[2.2.2]octanyl]pentanoate |
|---|---|
| PubChem CID | 167280371 |
| Molecular Formula | C37H50N4O5S2 |
| Molecular Weight | 694.96 g/mol |
| Exact Mass | 694.32 |
| IUPAC Name | propan-2-yl 5-[4-[5-[4-(benzylcarbamoylamino)-2-(tert-butylsulfamoyl)phenyl]-1,3-thiazol-2-yl]-1-bicyclo[2.2.2]octanyl]pentanoate |
| SMILES | CC(C)OC(=O)CCCCC12CCC(c3ncc(-c4ccc(NC(=O)NCc5ccccc5)cc4S(=O)(=O)NC(C)(C)C)s3)(CC1)CC2 |
| InChI | InChI=1S/C37H50N4O5S2/c1-26(2)46-32(42)13-9-10-16-36-17-20-37(21-18-36,22-19-36)33-38-25-30(47-33)29-15-14-28(23-31(29)48(44,45)41-35(3,4)5)40-34(43)39-24-27-11-7-6-8-12-27/h6-8,11-12,14-15,23,25-26,41H,9-10,13,16-22,24H2,1-5H3,(H2,39,40,43) |
| InChIKey | UOQXCVCPJPJYQQ-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.96 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|