C25H20N4O5S2 — CID 142516766
(4-nitrophenyl) N-[4-[5-(4-acetamido-2-methylsulfanylphenyl)-1,3-thiazol-2-yl]phenyl]carbamate (PubChem CID 142516766) has the molecular formula C25H20N4O5S2 and a molecular weight of 520.59 g/mol. Its IUPAC name is (4-nitrophenyl) N-[4-[5-(4-acetamido-2-methylsulfanylphenyl)-1,3-thiazol-2-yl]phenyl]carbamate.
| Compound Name | (4-nitrophenyl) N-[4-[5-(4-acetamido-2-methylsulfanylphenyl)-1,3-thiazol-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 142516766 |
| Molecular Formula | C25H20N4O5S2 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | (4-nitrophenyl) N-[4-[5-(4-acetamido-2-methylsulfanylphenyl)-1,3-thiazol-2-yl]phenyl]carbamate |
| SMILES | CSc1cc(NC(C)=O)ccc1-c1cnc(-c2ccc(NC(=O)Oc3ccc([N+](=O)[O-])cc3)cc2)s1 |
| InChI | InChI=1S/C25H20N4O5S2/c1-15(30)27-18-7-12-21(22(13-18)35-2)23-14-26-24(36-23)16-3-5-17(6-4-16)28-25(31)34-20-10-8-19(9-11-20)29(32)33/h3-14H,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | KZHZYHRUNIMZSM-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|