C14H11N3S2 — CID 107806262
4-(1,3-benzothiazol-6-ylamino)benzenecarbothioamide (PubChem CID 107806262) has the molecular formula C14H11N3S2 and a molecular weight of 285.40 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-6-ylamino)benzenecarbothioamide.
| Compound Name | 4-(1,3-benzothiazol-6-ylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107806262 |
| Molecular Formula | C14H11N3S2 |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 4-(1,3-benzothiazol-6-ylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Nc2ccc3ncsc3c2)cc1 |
| InChI | InChI=1S/C14H11N3S2/c15-14(18)9-1-3-10(4-2-9)17-11-5-6-12-13(7-11)19-8-16-12/h1-8,17H,(H2,15,18) |
| InChIKey | BREZXWFMGZORBX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|