C11H7N3O2S2 — CID 107806763
2-(1,3-benzothiazol-6-ylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 107806763) has the molecular formula C11H7N3O2S2 and a molecular weight of 277.33 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-6-ylamino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(1,3-benzothiazol-6-ylamino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107806763 |
| Molecular Formula | C11H7N3O2S2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | 2-(1,3-benzothiazol-6-ylamino)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(Nc2ccc3ncsc3c2)n1 |
| InChI | InChI=1S/C11H7N3O2S2/c15-10(16)8-4-17-11(14-8)13-6-1-2-7-9(3-6)18-5-12-7/h1-5H,(H,13,14)(H,15,16) |
| InChIKey | IXKVEVRNULAJAC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |