4-(1,3-benzothiazol-6-ylamino)-3,5-difluorobenzoic acid

C14H8F2N2O2S — CID 107805858

IUPAC4-(1,3-benzothiazol-6-ylamino)-3,5-difluorobenzoic acid
SMILESO=C(O)c1cc(F)c(Nc2ccc3ncsc3c2)c(F)c1
InChIInChI=1S/C14H8F2N2O2S/c15-9-3-7(14(19)20)4-10(16)13(9)18-8-1-2-11-12(5-8)21-6-17-11/h1-6,18H,(H,19,20)
InChIKeyYBDLTXTUMUKBKM-UHFFFAOYSA-N
MW306.29 g/mol
LogP4.02
Rot. Bonds3

About 4-(1,3-benzothiazol-6-ylamino)-3,5-difluorobenzoic acid

4-(1,3-benzothiazol-6-ylamino)-3,5-difluorobenzoic acid (PubChem CID 107805858) has the molecular formula C14H8F2N2O2S and a molecular weight of 306.29 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-6-ylamino)-3,5-difluorobenzoic acid.

Molecular Properties

Compound Name4-(1,3-benzothiazol-6-ylamino)-3,5-difluorobenzoic acid
PubChem CID107805858
Molecular FormulaC14H8F2N2O2S
Molecular Weight306.29 g/mol
Exact Mass306.03
IUPAC Name4-(1,3-benzothiazol-6-ylamino)-3,5-difluorobenzoic acid
SMILESO=C(O)c1cc(F)c(Nc2ccc3ncsc3c2)c(F)c1
InChIInChI=1S/C14H8F2N2O2S/c15-9-3-7(14(19)20)4-10(16)13(9)18-8-1-2-11-12(5-8)21-6-17-11/h1-6,18H,(H,19,20)
InChIKeyYBDLTXTUMUKBKM-UHFFFAOYSA-N
XLogP4.02
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.29
LogP ≤ 54.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-(1,3-benzothiazol-6-ylamino)-3,5-difluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,3-benzothiazol-6-ylamino)-3,5-difluorobenzoic acid?
The IUPAC name of 4-(1,3-benzothiazol-6-ylamino)-3,5-difluorobenzoic acid (CID 107805858) is 4-(1,3-benzothiazol-6-ylamino)-3,5-difluorobenzoic acid.
What is the SMILES notation for 4-(1,3-benzothiazol-6-ylamino)-3,5-difluorobenzoic acid?
The canonical SMILES for 4-(1,3-benzothiazol-6-ylamino)-3,5-difluorobenzoic acid is O=C(O)c1cc(F)c(Nc2ccc3ncsc3c2)c(F)c1.
What is the InChIKey of 4-(1,3-benzothiazol-6-ylamino)-3,5-difluorobenzoic acid?
The InChIKey is YBDLTXTUMUKBKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8F2N2O2S/c15-9-3-7(14(19)20)4-10(16)13(9)18-8-1-2-11-12(5-8)21-6-17-11/h1-6,18H,(H,19,20).
What are the key properties of 4-(1,3-benzothiazol-6-ylamino)-3,5-difluorobenzoic acid?
4-(1,3-benzothiazol-6-ylamino)-3,5-difluorobenzoic acid has a molecular weight of 306.29 g/mol, XLogP of 4.02, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzothiazol-6-ylamino)-3,5-difluorobenzoic acid is sourced from PubChem (CID 107805858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).