C14H8F2N2O2S — CID 107805858
4-(1,3-benzothiazol-6-ylamino)-3,5-difluorobenzoic acid (PubChem CID 107805858) has the molecular formula C14H8F2N2O2S and a molecular weight of 306.29 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-6-ylamino)-3,5-difluorobenzoic acid.
| Compound Name | 4-(1,3-benzothiazol-6-ylamino)-3,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 107805858 |
| Molecular Formula | C14H8F2N2O2S |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 4-(1,3-benzothiazol-6-ylamino)-3,5-difluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)c(Nc2ccc3ncsc3c2)c(F)c1 |
| InChI | InChI=1S/C14H8F2N2O2S/c15-9-3-7(14(19)20)4-10(16)13(9)18-8-1-2-11-12(5-8)21-6-17-11/h1-6,18H,(H,19,20) |
| InChIKey | YBDLTXTUMUKBKM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |