C13H10FN3S — CID 107802773
1-N-(1,3-benzothiazol-6-yl)-3-fluorobenzene-1,2-diamine (PubChem CID 107802773) has the molecular formula C13H10FN3S and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-N-(1,3-benzothiazol-6-yl)-3-fluorobenzene-1,2-diamine.
| Compound Name | 1-N-(1,3-benzothiazol-6-yl)-3-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 107802773 |
| Molecular Formula | C13H10FN3S |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 1-N-(1,3-benzothiazol-6-yl)-3-fluorobenzene-1,2-diamine |
| SMILES | Nc1c(F)cccc1Nc1ccc2ncsc2c1 |
| InChI | InChI=1S/C13H10FN3S/c14-9-2-1-3-11(13(9)15)17-8-4-5-10-12(6-8)18-7-16-10/h1-7,17H,15H2 |
| InChIKey | NRJQUVGNYQHSKL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|