C13H10ClFN4S — CID 107802827
1-N-(1,3-benzothiazol-6-yl)-5-chloro-6-fluorobenzene-1,2,4-triamine (PubChem CID 107802827) has the molecular formula C13H10ClFN4S and a molecular weight of 308.77 g/mol. Its IUPAC name is 1-N-(1,3-benzothiazol-6-yl)-5-chloro-6-fluorobenzene-1,2,4-triamine.
| Compound Name | 1-N-(1,3-benzothiazol-6-yl)-5-chloro-6-fluorobenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 107802827 |
| Molecular Formula | C13H10ClFN4S |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 1-N-(1,3-benzothiazol-6-yl)-5-chloro-6-fluorobenzene-1,2,4-triamine |
| SMILES | Nc1cc(N)c(Nc2ccc3ncsc3c2)c(F)c1Cl |
| InChI | InChI=1S/C13H10ClFN4S/c14-11-7(16)4-8(17)13(12(11)15)19-6-1-2-9-10(3-6)20-5-18-9/h1-5,19H,16-17H2 |
| InChIKey | QTSNRRMMMDGOLU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|