C13H12N4S — CID 107802793
2-N-(1,3-benzothiazol-6-yl)-6-methylpyridine-2,5-diamine (PubChem CID 107802793) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is 2-N-(1,3-benzothiazol-6-yl)-6-methylpyridine-2,5-diamine.
| Compound Name | 2-N-(1,3-benzothiazol-6-yl)-6-methylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 107802793 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-N-(1,3-benzothiazol-6-yl)-6-methylpyridine-2,5-diamine |
| SMILES | Cc1nc(Nc2ccc3ncsc3c2)ccc1N |
| InChI | InChI=1S/C13H12N4S/c1-8-10(14)3-5-13(16-8)17-9-2-4-11-12(6-9)18-7-15-11/h2-7H,14H2,1H3,(H,16,17) |
| InChIKey | YJDJOIDLRIDWCZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |