C15H17N5S — CID 107801962
4-N-(1,3-benzothiazol-6-yl)-2-tert-butylpyrimidine-4,6-diamine (PubChem CID 107801962) has the molecular formula C15H17N5S and a molecular weight of 299.40 g/mol. Its IUPAC name is 4-N-(1,3-benzothiazol-6-yl)-2-tert-butylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(1,3-benzothiazol-6-yl)-2-tert-butylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 107801962 |
| Molecular Formula | C15H17N5S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 4-N-(1,3-benzothiazol-6-yl)-2-tert-butylpyrimidine-4,6-diamine |
| SMILES | CC(C)(C)c1nc(N)cc(Nc2ccc3ncsc3c2)n1 |
| InChI | InChI=1S/C15H17N5S/c1-15(2,3)14-19-12(16)7-13(20-14)18-9-4-5-10-11(6-9)21-8-17-10/h4-8H,1-3H3,(H3,16,18,19,20) |
| InChIKey | YEFMIVKVJYAMHF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |