About 2-N-(1,3-benzothiazol-6-yl)-6-N-ethylpyrazine-2,6-diamine
2-N-(1,3-benzothiazol-6-yl)-6-N-ethylpyrazine-2,6-diamine (PubChem CID 107802020) has the molecular formula C13H13N5S
and a molecular weight of 271.35 g/mol. Its IUPAC name is 2-N-(1,3-benzothiazol-6-yl)-6-N-ethylpyrazine-2,6-diamine.
Molecular Properties
| Compound Name | 2-N-(1,3-benzothiazol-6-yl)-6-N-ethylpyrazine-2,6-diamine |
| PubChem CID | 107802020 |
| Molecular Formula | C13H13N5S |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-N-(1,3-benzothiazol-6-yl)-6-N-ethylpyrazine-2,6-diamine |
| SMILES | CCNc1cncc(Nc2ccc3ncsc3c2)n1 |
| InChI | InChI=1S/C13H13N5S/c1-2-15-12-6-14-7-13(18-12)17-9-3-4-10-11(5-9)19-8-16-10/h3-8H,2H2,1H3,(H2,15,17,18) |
| InChIKey | KWPQMSHCMUXEFZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-N-(1,3-benzothiazol-6-yl)-6-N-ethylpyrazine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(1,3-benzothiazol-6-yl)-6-N-ethylpyrazine-2,6-diamine?
The IUPAC name of 2-N-(1,3-benzothiazol-6-yl)-6-N-ethylpyrazine-2,6-diamine (CID 107802020) is 2-N-(1,3-benzothiazol-6-yl)-6-N-ethylpyrazine-2,6-diamine.
What is the SMILES notation for 2-N-(1,3-benzothiazol-6-yl)-6-N-ethylpyrazine-2,6-diamine?
The canonical SMILES for 2-N-(1,3-benzothiazol-6-yl)-6-N-ethylpyrazine-2,6-diamine is CCNc1cncc(Nc2ccc3ncsc3c2)n1.
What is the InChIKey of 2-N-(1,3-benzothiazol-6-yl)-6-N-ethylpyrazine-2,6-diamine?
The InChIKey is KWPQMSHCMUXEFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N5S/c1-2-15-12-6-14-7-13(18-12)17-9-3-4-10-11(5-9)19-8-16-10/h3-8H,2H2,1H3,(H2,15,17,18).
What are the key properties of 2-N-(1,3-benzothiazol-6-yl)-6-N-ethylpyrazine-2,6-diamine?
2-N-(1,3-benzothiazol-6-yl)-6-N-ethylpyrazine-2,6-diamine has a molecular weight of 271.35 g/mol, XLogP of 3.26, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(1,3-benzothiazol-6-yl)-6-N-ethylpyrazine-2,6-diamine is sourced from PubChem (CID 107802020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).