C12H12BrFN4 — CID 80843376
2-N-(4-bromo-3-fluorophenyl)-6-N-ethylpyrazine-2,6-diamine (PubChem CID 80843376) has the molecular formula C12H12BrFN4 and a molecular weight of 311.16 g/mol. Its IUPAC name is 2-N-(4-bromo-3-fluorophenyl)-6-N-ethylpyrazine-2,6-diamine.
| Compound Name | 2-N-(4-bromo-3-fluorophenyl)-6-N-ethylpyrazine-2,6-diamine |
|---|---|
| PubChem CID | 80843376 |
| Molecular Formula | C12H12BrFN4 |
| Molecular Weight | 311.16 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 2-N-(4-bromo-3-fluorophenyl)-6-N-ethylpyrazine-2,6-diamine |
| SMILES | CCNc1cncc(Nc2ccc(Br)c(F)c2)n1 |
| InChI | InChI=1S/C12H12BrFN4/c1-2-16-11-6-15-7-12(18-11)17-8-3-4-9(13)10(14)5-8/h3-7H,2H2,1H3,(H2,16,17,18) |
| InChIKey | XILVQODTOTXLMA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.16 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |