C12H11BrF2N4 — CID 102855613
2-N-(5-bromo-2,4-difluorophenyl)-6-N-ethylpyrazine-2,6-diamine (PubChem CID 102855613) has the molecular formula C12H11BrF2N4 and a molecular weight of 329.15 g/mol. Its IUPAC name is 2-N-(5-bromo-2,4-difluorophenyl)-6-N-ethylpyrazine-2,6-diamine.
| Compound Name | 2-N-(5-bromo-2,4-difluorophenyl)-6-N-ethylpyrazine-2,6-diamine |
|---|---|
| PubChem CID | 102855613 |
| Molecular Formula | C12H11BrF2N4 |
| Molecular Weight | 329.15 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 2-N-(5-bromo-2,4-difluorophenyl)-6-N-ethylpyrazine-2,6-diamine |
| SMILES | CCNc1cncc(Nc2cc(Br)c(F)cc2F)n1 |
| InChI | InChI=1S/C12H11BrF2N4/c1-2-17-11-5-16-6-12(19-11)18-10-3-7(13)8(14)4-9(10)15/h3-6H,2H2,1H3,(H2,17,18,19) |
| InChIKey | QAKGESSFPSUWLS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.15 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|