C14H15BrF2N4 — CID 107608393
4-N-(4-bromo-2,5-difluorophenyl)-6-N,2-diethylpyrimidine-4,6-diamine (PubChem CID 107608393) has the molecular formula C14H15BrF2N4 and a molecular weight of 357.20 g/mol. Its IUPAC name is 4-N-(4-bromo-2,5-difluorophenyl)-6-N,2-diethylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(4-bromo-2,5-difluorophenyl)-6-N,2-diethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 107608393 |
| Molecular Formula | C14H15BrF2N4 |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 4-N-(4-bromo-2,5-difluorophenyl)-6-N,2-diethylpyrimidine-4,6-diamine |
| SMILES | CCNc1cc(Nc2cc(F)c(Br)cc2F)nc(CC)n1 |
| InChI | InChI=1S/C14H15BrF2N4/c1-3-12-20-13(18-4-2)7-14(21-12)19-11-6-9(16)8(15)5-10(11)17/h5-7H,3-4H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | MAHBKUQMXLUNFU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|