C14H16ClFN4 — CID 80934267
4-N-(5-chloro-2-fluorophenyl)-6-N,2-diethylpyrimidine-4,6-diamine (PubChem CID 80934267) has the molecular formula C14H16ClFN4 and a molecular weight of 294.76 g/mol. Its IUPAC name is 4-N-(5-chloro-2-fluorophenyl)-6-N,2-diethylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(5-chloro-2-fluorophenyl)-6-N,2-diethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80934267 |
| Molecular Formula | C14H16ClFN4 |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-N-(5-chloro-2-fluorophenyl)-6-N,2-diethylpyrimidine-4,6-diamine |
| SMILES | CCNc1cc(Nc2cc(Cl)ccc2F)nc(CC)n1 |
| InChI | InChI=1S/C14H16ClFN4/c1-3-12-19-13(17-4-2)8-14(20-12)18-11-7-9(15)5-6-10(11)16/h5-8H,3-4H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | YCDNALRFKORYOP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |