C11H7ClN4S — CID 107268509
N-(6-chloropyrazin-2-yl)-1,3-benzothiazol-6-amine (PubChem CID 107268509) has the molecular formula C11H7ClN4S and a molecular weight of 262.73 g/mol. Its IUPAC name is N-(6-chloropyrazin-2-yl)-1,3-benzothiazol-6-amine.
| Compound Name | N-(6-chloropyrazin-2-yl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 107268509 |
| Molecular Formula | C11H7ClN4S |
| Molecular Weight | 262.73 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | N-(6-chloropyrazin-2-yl)-1,3-benzothiazol-6-amine |
| SMILES | Clc1cncc(Nc2ccc3ncsc3c2)n1 |
| InChI | InChI=1S/C11H7ClN4S/c12-10-4-13-5-11(16-10)15-7-1-2-8-9(3-7)17-6-14-8/h1-6H,(H,15,16) |
| InChIKey | WHKPDWZPKBLRDZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.73 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |