C14H12FN3S — CID 107802771
1-N-(1,3-benzothiazol-6-yl)-4-fluoro-5-methylbenzene-1,2-diamine (PubChem CID 107802771) has the molecular formula C14H12FN3S and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-N-(1,3-benzothiazol-6-yl)-4-fluoro-5-methylbenzene-1,2-diamine.
| Compound Name | 1-N-(1,3-benzothiazol-6-yl)-4-fluoro-5-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 107802771 |
| Molecular Formula | C14H12FN3S |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 1-N-(1,3-benzothiazol-6-yl)-4-fluoro-5-methylbenzene-1,2-diamine |
| SMILES | Cc1cc(Nc2ccc3ncsc3c2)c(N)cc1F |
| InChI | InChI=1S/C14H12FN3S/c1-8-4-13(11(16)6-10(8)15)18-9-2-3-12-14(5-9)19-7-17-12/h2-7,18H,16H2,1H3 |
| InChIKey | NDKWXQAQXSQPMM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|