C14H10BrN3S2 — CID 107806301
2-(1,3-benzothiazol-6-ylamino)-6-bromobenzenecarbothioamide (PubChem CID 107806301) has the molecular formula C14H10BrN3S2 and a molecular weight of 364.29 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-6-ylamino)-6-bromobenzenecarbothioamide.
| Compound Name | 2-(1,3-benzothiazol-6-ylamino)-6-bromobenzenecarbothioamide |
|---|---|
| PubChem CID | 107806301 |
| Molecular Formula | C14H10BrN3S2 |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 362.95 |
| IUPAC Name | 2-(1,3-benzothiazol-6-ylamino)-6-bromobenzenecarbothioamide |
| SMILES | NC(=S)c1c(Br)cccc1Nc1ccc2ncsc2c1 |
| InChI | InChI=1S/C14H10BrN3S2/c15-9-2-1-3-11(13(9)14(16)19)18-8-4-5-10-12(6-8)20-7-17-10/h1-7,18H,(H2,16,19) |
| InChIKey | JNWYOPUQODEYRJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|