C14H8FN3S — CID 107805491
4-(1,3-benzothiazol-6-ylamino)-2-fluorobenzonitrile (PubChem CID 107805491) has the molecular formula C14H8FN3S and a molecular weight of 269.30 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-6-ylamino)-2-fluorobenzonitrile.
| Compound Name | 4-(1,3-benzothiazol-6-ylamino)-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 107805491 |
| Molecular Formula | C14H8FN3S |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 4-(1,3-benzothiazol-6-ylamino)-2-fluorobenzonitrile |
| SMILES | N#Cc1ccc(Nc2ccc3ncsc3c2)cc1F |
| InChI | InChI=1S/C14H8FN3S/c15-12-5-10(2-1-9(12)7-16)18-11-3-4-13-14(6-11)19-8-17-13/h1-6,8,18H |
| InChIKey | GNDWZYBABFDXKN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |