4-(4-bromo-3-methoxyanilino)-3,5-difluorobenzoic acid

C14H10BrF2NO3 — CID 82859212

IUPAC4-(4-bromo-3-methoxyanilino)-3,5-difluorobenzoic acid
SMILESCOc1cc(Nc2c(F)cc(C(=O)O)cc2F)ccc1Br
InChIInChI=1S/C14H10BrF2NO3/c1-21-12-6-8(2-3-9(12)15)18-13-10(16)4-7(14(19)20)5-11(13)17/h2-6,18H,1H3,(H,19,20)
InChIKeyXVWMNYDHDUCNAF-UHFFFAOYSA-N
MW358.14 g/mol
LogP4.18
Rot. Bonds4

About 4-(4-bromo-3-methoxyanilino)-3,5-difluorobenzoic acid

4-(4-bromo-3-methoxyanilino)-3,5-difluorobenzoic acid (PubChem CID 82859212) has the molecular formula C14H10BrF2NO3 and a molecular weight of 358.14 g/mol. Its IUPAC name is 4-(4-bromo-3-methoxyanilino)-3,5-difluorobenzoic acid.

Molecular Properties

Compound Name4-(4-bromo-3-methoxyanilino)-3,5-difluorobenzoic acid
PubChem CID82859212
Molecular FormulaC14H10BrF2NO3
Molecular Weight358.14 g/mol
Exact Mass356.98
IUPAC Name4-(4-bromo-3-methoxyanilino)-3,5-difluorobenzoic acid
SMILESCOc1cc(Nc2c(F)cc(C(=O)O)cc2F)ccc1Br
InChIInChI=1S/C14H10BrF2NO3/c1-21-12-6-8(2-3-9(12)15)18-13-10(16)4-7(14(19)20)5-11(13)17/h2-6,18H,1H3,(H,19,20)
InChIKeyXVWMNYDHDUCNAF-UHFFFAOYSA-N
XLogP4.18
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500358.14
LogP ≤ 54.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(4-bromo-3-methoxyanilino)-3,5-difluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-bromo-3-methoxyanilino)-3,5-difluorobenzoic acid?
The IUPAC name of 4-(4-bromo-3-methoxyanilino)-3,5-difluorobenzoic acid (CID 82859212) is 4-(4-bromo-3-methoxyanilino)-3,5-difluorobenzoic acid.
What is the SMILES notation for 4-(4-bromo-3-methoxyanilino)-3,5-difluorobenzoic acid?
The canonical SMILES for 4-(4-bromo-3-methoxyanilino)-3,5-difluorobenzoic acid is COc1cc(Nc2c(F)cc(C(=O)O)cc2F)ccc1Br.
What is the InChIKey of 4-(4-bromo-3-methoxyanilino)-3,5-difluorobenzoic acid?
The InChIKey is XVWMNYDHDUCNAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrF2NO3/c1-21-12-6-8(2-3-9(12)15)18-13-10(16)4-7(14(19)20)5-11(13)17/h2-6,18H,1H3,(H,19,20).
What are the key properties of 4-(4-bromo-3-methoxyanilino)-3,5-difluorobenzoic acid?
4-(4-bromo-3-methoxyanilino)-3,5-difluorobenzoic acid has a molecular weight of 358.14 g/mol, XLogP of 4.18, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromo-3-methoxyanilino)-3,5-difluorobenzoic acid is sourced from PubChem (CID 82859212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).