C22H15N5O5 — CID 3403486
N'-(2,4-dinitrophenyl)-2-phenylquinoline-4-carbohydrazide (PubChem CID 3403486) has the molecular formula C22H15N5O5 and a molecular weight of 429.39 g/mol. Its IUPAC name is N'-(2,4-dinitrophenyl)-2-phenylquinoline-4-carbohydrazide.
| Compound Name | N'-(2,4-dinitrophenyl)-2-phenylquinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 3403486 |
| Molecular Formula | C22H15N5O5 |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N'-(2,4-dinitrophenyl)-2-phenylquinoline-4-carbohydrazide |
| SMILES | O=C(NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C22H15N5O5/c28-22(25-24-19-11-10-15(26(29)30)12-21(19)27(31)32)17-13-20(14-6-2-1-3-7-14)23-18-9-5-4-8-16(17)18/h1-13,24H,(H,25,28) |
| InChIKey | RFDXGVQWORNFEK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 140.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|