C25H20N4O4S — CID 3680478
N-[(4-ethoxy-2-nitrophenyl)carbamothioyl]-2-phenylquinoline-4-carboxamide (PubChem CID 3680478) has the molecular formula C25H20N4O4S and a molecular weight of 472.53 g/mol. Its IUPAC name is N-[(4-ethoxy-2-nitrophenyl)carbamothioyl]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(4-ethoxy-2-nitrophenyl)carbamothioyl]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 3680478 |
| Molecular Formula | C25H20N4O4S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | N-[(4-ethoxy-2-nitrophenyl)carbamothioyl]-2-phenylquinoline-4-carboxamide |
| SMILES | CCOc1ccc(NC(=S)NC(=O)c2cc(-c3ccccc3)nc3ccccc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H20N4O4S/c1-2-33-17-12-13-21(23(14-17)29(31)32)27-25(34)28-24(30)19-15-22(16-8-4-3-5-9-16)26-20-11-7-6-10-18(19)20/h3-15H,2H2,1H3,(H2,27,28,30,34) |
| InChIKey | QCQSYPGZMRNASP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|