C25H21N3O5 — CID 1290094
2-(4-ethoxyphenyl)-N-(2-methoxy-5-nitrophenyl)quinoline-4-carboxamide (PubChem CID 1290094) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N-(2-methoxy-5-nitrophenyl)quinoline-4-carboxamide.
| Compound Name | 2-(4-ethoxyphenyl)-N-(2-methoxy-5-nitrophenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 1290094 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N-(2-methoxy-5-nitrophenyl)quinoline-4-carboxamide |
| SMILES | CCOc1ccc(-c2cc(C(=O)Nc3cc([N+](=O)[O-])ccc3OC)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C25H21N3O5/c1-3-33-18-11-8-16(9-12-18)22-15-20(19-6-4-5-7-21(19)26-22)25(29)27-23-14-17(28(30)31)10-13-24(23)32-2/h4-15H,3H2,1-2H3,(H,27,29) |
| InChIKey | BGHUBTBRXOCHLE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|