C31H21BrN4O6 — CID 23993278
[2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-[(2-phenylquinoline-4-carbonyl)amino]benzoate (PubChem CID 23993278) has the molecular formula C31H21BrN4O6 and a molecular weight of 625.44 g/mol. Its IUPAC name is [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-[(2-phenylquinoline-4-carbonyl)amino]benzoate.
| Compound Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-[(2-phenylquinoline-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 23993278 |
| Molecular Formula | C31H21BrN4O6 |
| Molecular Weight | 625.44 g/mol |
| Exact Mass | 624.06 |
| IUPAC Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-[(2-phenylquinoline-4-carbonyl)amino]benzoate |
| SMILES | O=C(COC(=O)c1ccccc1NC(=O)c1cc(-c2ccccc2)nc2ccccc12)Nc1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C31H21BrN4O6/c32-24-16-20(36(40)41)14-15-27(24)34-29(37)18-42-31(39)22-11-5-7-13-26(22)35-30(38)23-17-28(19-8-2-1-3-9-19)33-25-12-6-4-10-21(23)25/h1-17H,18H2,(H,34,37)(H,35,38) |
| InChIKey | KUHNSFVFGFXTRE-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.44 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|