C24H18N4O6 — CID 23913495
[2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-pyridin-2-ylquinoline-4-carboxylate (PubChem CID 23913495) has the molecular formula C24H18N4O6 and a molecular weight of 458.43 g/mol. Its IUPAC name is [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-pyridin-2-ylquinoline-4-carboxylate.
| Compound Name | [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-pyridin-2-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 23913495 |
| Molecular Formula | C24H18N4O6 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-pyridin-2-ylquinoline-4-carboxylate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)COC(=O)c1cc(-c2ccccn2)nc2ccccc12 |
| InChI | InChI=1S/C24H18N4O6/c1-33-22-10-9-15(28(31)32)12-21(22)27-23(29)14-34-24(30)17-13-20(19-8-4-5-11-25-19)26-18-7-3-2-6-16(17)18/h2-13H,14H2,1H3,(H,27,29) |
| InChIKey | RZJUFWNNOOIQPI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|