About [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-phenylbenzoate
[2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-phenylbenzoate (PubChem CID 7229241) has the molecular formula C22H18N2O6
and a molecular weight of 406.39 g/mol. Its IUPAC name is [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-phenylbenzoate.
Molecular Properties
| Compound Name | [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-phenylbenzoate |
| PubChem CID | 7229241 |
| Molecular Formula | C22H18N2O6 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-phenylbenzoate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)COC(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C22H18N2O6/c1-29-20-12-11-16(24(27)28)13-19(20)23-21(25)14-30-22(26)18-10-6-5-9-17(18)15-7-3-2-4-8-15/h2-13H,14H2,1H3,(H,23,25) |
| InChIKey | KKPUGBWPRGDOFB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-phenylbenzoate?
The IUPAC name of [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-phenylbenzoate (CID 7229241) is [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-phenylbenzoate.
What is the SMILES notation for [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-phenylbenzoate?
The canonical SMILES for [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-phenylbenzoate is COc1ccc([N+](=O)[O-])cc1NC(=O)COC(=O)c1ccccc1-c1ccccc1.
What is the InChIKey of [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-phenylbenzoate?
The InChIKey is KKPUGBWPRGDOFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2O6/c1-29-20-12-11-16(24(27)28)13-19(20)23-21(25)14-30-22(26)18-10-6-5-9-17(18)15-7-3-2-4-8-15/h2-13H,14H2,1H3,(H,23,25).
What are the key properties of [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-phenylbenzoate?
[2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-phenylbenzoate has a molecular weight of 406.39 g/mol, XLogP of 4.07, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 2-phenylbenzoate is sourced from PubChem (CID 7229241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).