C26H19F2N3O7 — CID 4988574
[2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-[4-(difluoromethoxy)phenyl]quinoline-4-carboxylate (PubChem CID 4988574) has the molecular formula C26H19F2N3O7 and a molecular weight of 523.45 g/mol. Its IUPAC name is [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-[4-(difluoromethoxy)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-[4-(difluoromethoxy)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4988574 |
| Molecular Formula | C26H19F2N3O7 |
| Molecular Weight | 523.45 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 2-[4-(difluoromethoxy)phenyl]quinoline-4-carboxylate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)c1cc(-c2ccc(OC(F)F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C26H19F2N3O7/c1-36-23-12-16(31(34)35)8-11-21(23)30-24(32)14-37-25(33)19-13-22(29-20-5-3-2-4-18(19)20)15-6-9-17(10-7-15)38-26(27)28/h2-13,26H,14H2,1H3,(H,30,32) |
| InChIKey | UQLGJKPUKUIIBU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|