C29H27N3O9 — CID 23932754
[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate (PubChem CID 23932754) has the molecular formula C29H27N3O9 and a molecular weight of 561.55 g/mol. Its IUPAC name is [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate.
| Compound Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 23932754 |
| Molecular Formula | C29H27N3O9 |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate |
| SMILES | COc1cc(NC(=O)COC(=O)c2cc(-c3cc(OC)c(OC)c(OC)c3)nc3ccccc23)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H27N3O9/c1-16-10-23(32(35)36)24(37-2)14-21(16)31-27(33)15-41-29(34)19-13-22(30-20-9-7-6-8-18(19)20)17-11-25(38-3)28(40-5)26(12-17)39-4/h6-14H,15H2,1-5H3,(H,31,33) |
| InChIKey | HDUQGTISVXRVHD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|