C17H16N2O8 — CID 7870798
[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 2,4-dihydroxybenzoate (PubChem CID 7870798) has the molecular formula C17H16N2O8 and a molecular weight of 376.32 g/mol. Its IUPAC name is [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 2,4-dihydroxybenzoate.
| Compound Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 7870798 |
| Molecular Formula | C17H16N2O8 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 2,4-dihydroxybenzoate |
| SMILES | COc1cc(NC(=O)COC(=O)c2ccc(O)cc2O)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16N2O8/c1-9-5-13(19(24)25)15(26-2)7-12(9)18-16(22)8-27-17(23)11-4-3-10(20)6-14(11)21/h3-7,20-21H,8H2,1-2H3,(H,18,22) |
| InChIKey | UMOTVSNZLSGARN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|