C25H18N2O8 — CID 4263660
[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate (PubChem CID 4263660) has the molecular formula C25H18N2O8 and a molecular weight of 474.43 g/mol. Its IUPAC name is [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 4263660 |
| Molecular Formula | C25H18N2O8 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
| SMILES | COc1cc(NC(=O)COC(=O)c2cccc3c2C(=O)c2ccccc2C3=O)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H18N2O8/c1-13-10-19(27(32)33)20(34-2)11-18(13)26-21(28)12-35-25(31)17-9-5-8-16-22(17)24(30)15-7-4-3-6-14(15)23(16)29/h3-11H,12H2,1-2H3,(H,26,28) |
| InChIKey | NLWAAHMRYFYJQH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|