C29H25N3O5 — CID 23828684
(2-morpholin-4-yl-2-oxoethyl) 2-[(2-phenylquinoline-4-carbonyl)amino]benzoate (PubChem CID 23828684) has the molecular formula C29H25N3O5 and a molecular weight of 495.54 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) 2-[(2-phenylquinoline-4-carbonyl)amino]benzoate.
| Compound Name | (2-morpholin-4-yl-2-oxoethyl) 2-[(2-phenylquinoline-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 23828684 |
| Molecular Formula | C29H25N3O5 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | (2-morpholin-4-yl-2-oxoethyl) 2-[(2-phenylquinoline-4-carbonyl)amino]benzoate |
| SMILES | O=C(OCC(=O)N1CCOCC1)c1ccccc1NC(=O)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C29H25N3O5/c33-27(32-14-16-36-17-15-32)19-37-29(35)22-11-5-7-13-25(22)31-28(34)23-18-26(20-8-2-1-3-9-20)30-24-12-6-4-10-21(23)24/h1-13,18H,14-17,19H2,(H,31,34) |
| InChIKey | BXQRGCOJAZMNTL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |