C22H14BrN3O5 — CID 27704595
[2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-(2-cyanophenyl)benzoate (PubChem CID 27704595) has the molecular formula C22H14BrN3O5 and a molecular weight of 480.27 g/mol. Its IUPAC name is [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-(2-cyanophenyl)benzoate.
| Compound Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-(2-cyanophenyl)benzoate |
|---|---|
| PubChem CID | 27704595 |
| Molecular Formula | C22H14BrN3O5 |
| Molecular Weight | 480.27 g/mol |
| Exact Mass | 479.01 |
| IUPAC Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 2-(2-cyanophenyl)benzoate |
| SMILES | N#Cc1ccccc1-c1ccccc1C(=O)OCC(=O)Nc1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C22H14BrN3O5/c23-19-11-15(26(29)30)9-10-20(19)25-21(27)13-31-22(28)18-8-4-3-7-17(18)16-6-2-1-5-14(16)12-24/h1-11H,13H2,(H,25,27) |
| InChIKey | GBZDAYLXYLMEPE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.27 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|