C19H12BrClN2O6 — CID 29498682
[2-(2-bromo-4-nitroanilino)-2-oxoethyl] 5-(2-chlorophenyl)furan-2-carboxylate (PubChem CID 29498682) has the molecular formula C19H12BrClN2O6 and a molecular weight of 479.67 g/mol. Its IUPAC name is [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 5-(2-chlorophenyl)furan-2-carboxylate.
| Compound Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 5-(2-chlorophenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 29498682 |
| Molecular Formula | C19H12BrClN2O6 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 477.96 |
| IUPAC Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 5-(2-chlorophenyl)furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(-c2ccccc2Cl)o1)Nc1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C19H12BrClN2O6/c20-13-9-11(23(26)27)5-6-15(13)22-18(24)10-28-19(25)17-8-7-16(29-17)12-3-1-2-4-14(12)21/h1-9H,10H2,(H,22,24) |
| InChIKey | XQGRUIIXDSRKKO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|