C16H11ClN2O6 — CID 8568937
[2-oxo-2-(prop-2-ynylamino)ethyl] 5-(2-chloro-4-nitrophenyl)furan-2-carboxylate (PubChem CID 8568937) has the molecular formula C16H11ClN2O6 and a molecular weight of 362.73 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] 5-(2-chloro-4-nitrophenyl)furan-2-carboxylate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 5-(2-chloro-4-nitrophenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 8568937 |
| Molecular Formula | C16H11ClN2O6 |
| Molecular Weight | 362.73 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 5-(2-chloro-4-nitrophenyl)furan-2-carboxylate |
| SMILES | C#CCNC(=O)COC(=O)c1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1 |
| InChI | InChI=1S/C16H11ClN2O6/c1-2-7-18-15(20)9-24-16(21)14-6-5-13(25-14)11-4-3-10(19(22)23)8-12(11)17/h1,3-6,8H,7,9H2,(H,18,20) |
| InChIKey | WGFOTLSABZDINJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.73 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|