C18H17ClN2O6 — CID 8568941
[2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 5-(2-chloro-4-nitrophenyl)furan-2-carboxylate (PubChem CID 8568941) has the molecular formula C18H17ClN2O6 and a molecular weight of 392.80 g/mol. Its IUPAC name is [2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 5-(2-chloro-4-nitrophenyl)furan-2-carboxylate.
| Compound Name | [2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 5-(2-chloro-4-nitrophenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 8568941 |
| Molecular Formula | C18H17ClN2O6 |
| Molecular Weight | 392.80 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | [2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 5-(2-chloro-4-nitrophenyl)furan-2-carboxylate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1)C1CC1 |
| InChI | InChI=1S/C18H17ClN2O6/c1-10(11-2-3-11)20-17(22)9-26-18(23)16-7-6-15(27-16)13-5-4-12(21(24)25)8-14(13)19/h4-8,10-11H,2-3,9H2,1H3,(H,20,22)/t10-/m1/s1 |
| InChIKey | WBDJCNBSOBLGDC-SNVBAGLBSA-N |
| XLogP | 3.58 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.80 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|