C20H16ClN3O5 — CID 9088085
5-(2-chloro-4-nitrophenyl)-N'-(4-ethylbenzoyl)furan-2-carbohydrazide (PubChem CID 9088085) has the molecular formula C20H16ClN3O5 and a molecular weight of 413.82 g/mol. Its IUPAC name is 5-(2-chloro-4-nitrophenyl)-N'-(4-ethylbenzoyl)furan-2-carbohydrazide.
| Compound Name | 5-(2-chloro-4-nitrophenyl)-N'-(4-ethylbenzoyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 9088085 |
| Molecular Formula | C20H16ClN3O5 |
| Molecular Weight | 413.82 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 5-(2-chloro-4-nitrophenyl)-N'-(4-ethylbenzoyl)furan-2-carbohydrazide |
| SMILES | CCc1ccc(C(=O)NNC(=O)c2ccc(-c3ccc([N+](=O)[O-])cc3Cl)o2)cc1 |
| InChI | InChI=1S/C20H16ClN3O5/c1-2-12-3-5-13(6-4-12)19(25)22-23-20(26)18-10-9-17(29-18)15-8-7-14(24(27)28)11-16(15)21/h3-11H,2H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | DKDRVSUNJJJDAO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.82 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|