C18H20ClN3O4 — CID 95776761
5-(2-chloro-4-nitrophenyl)-N-[(1R,2S)-2-(dimethylamino)cyclopentyl]furan-2-carboxamide (PubChem CID 95776761) has the molecular formula C18H20ClN3O4 and a molecular weight of 377.83 g/mol. Its IUPAC name is 5-(2-chloro-4-nitrophenyl)-N-[(1R,2S)-2-(dimethylamino)cyclopentyl]furan-2-carboxamide.
| Compound Name | 5-(2-chloro-4-nitrophenyl)-N-[(1R,2S)-2-(dimethylamino)cyclopentyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 95776761 |
| Molecular Formula | C18H20ClN3O4 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 5-(2-chloro-4-nitrophenyl)-N-[(1R,2S)-2-(dimethylamino)cyclopentyl]furan-2-carboxamide |
| SMILES | CN(C)[C@H]1CCC[C@H]1NC(=O)c1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1 |
| InChI | InChI=1S/C18H20ClN3O4/c1-21(2)15-5-3-4-14(15)20-18(23)17-9-8-16(26-17)12-7-6-11(22(24)25)10-13(12)19/h6-10,14-15H,3-5H2,1-2H3,(H,20,23)/t14-,15+/m1/s1 |
| InChIKey | VHLOMDKNWKUCMP-CABCVRRESA-N |
| XLogP | 3.72 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|